CAS 5117-55-5 is the registry number for Methyl 3–hydroxy–1–benzofuran–2–carboxylate. Offered by: GLPBio. Available pack sizes: 200mg.
Methyl 3-hydroxy-1-benzofuran-2-carboxylate (CAS 5117-55-5) is a chemical compound with the molecular formula C10H8O4 and a molecular weight of 192.17 g/mol. IUPAC name: methyl 3-hydroxy-1-benzofuran-2-carboxylate. InChIKey: HOWXDNGXHMYIIK-UHFFFAOYSA-N.
| Molecular formula | C10H8O4 |
|---|---|
| Molecular weight | 192.17 g/mol |
| IUPAC name | methyl 3-hydroxy-1-benzofuran-2-carboxylate |
| InChIKey | HOWXDNGXHMYIIK-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C2=CC=CC=C2O1)O |
Computed by PubChem (NCBI)