CAS 5118-94-5 appears in our catalog under these names: 3,4-Dihydro-1H-1,4-benzodiazepine-2,5-dione, 98%, 98%, 3,4-Dihydro-1H-1,4-benzodiazepine-2,5-dione, 98%, 3,4-Dihydro-1H-1,4-benzodiazepine-2,5-dione, 97%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 5g, 100mg, 25g.
3,4-dihydro-1H-1,4-benzodiazepine-2,5-dione (CAS 5118-94-5) is a chemical compound with the molecular formula C9H8N2O2 and a molecular weight of 176.17 g/mol. IUPAC name: 3,4-dihydro-1H-1,4-benzodiazepine-2,5-dione. InChIKey: AZHGGDCFQPMANU-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O2 |
|---|---|
| Molecular weight | 176.17 g/mol |
| IUPAC name | 3,4-dihydro-1H-1,4-benzodiazepine-2,5-dione |
| InChIKey | AZHGGDCFQPMANU-UHFFFAOYSA-N |
| SMILES | C1C(=O)NC2=CC=CC=C2C(=O)N1 |
Computed by PubChem (NCBI)