CAS 5119-79-9 is the registry number for 7-Methoxy-2,3-dihydroisoquinolin-4(1H)-one Hydrochloride. Offered by: TRC. Available pack sizes: 1g.
7-methoxy-2,3-dihydro-1H-isoquinolin-4-one;hydrochloride (CAS 5119-79-9) is a chemical compound with the molecular formula C10H12ClNO2 and a molecular weight of 213.66 g/mol. IUPAC name: 7-methoxy-2,3-dihydro-1H-isoquinolin-4-one;hydrochloride. InChIKey: SHBTUJZZAAJBPW-UHFFFAOYSA-N.
| Molecular formula | C10H12ClNO2 |
|---|---|
| Molecular weight | 213.66 g/mol |
| IUPAC name | 7-methoxy-2,3-dihydro-1H-isoquinolin-4-one;hydrochloride |
| InChIKey | SHBTUJZZAAJBPW-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)C(=O)CNC2.Cl |
Computed by PubChem (NCBI)