CAS 51264-59-6 appears in our catalog under these names: 4-Hydroxy-2'-nitrobiphenyl, 95%, 2-Nitro-(1,1'-biphenyl)-4-ol, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
4-(2-nitrophenyl)phenol (CAS 51264-59-6) is a chemical compound with the molecular formula C12H9NO3 and a molecular weight of 215.20 g/mol. IUPAC name: 4-(2-nitrophenyl)phenol. InChIKey: NRRCMTITSCFYOH-UHFFFAOYSA-N.
| Molecular formula | C12H9NO3 |
|---|---|
| Molecular weight | 215.20 g/mol |
| IUPAC name | 4-(2-nitrophenyl)phenol |
| InChIKey | NRRCMTITSCFYOH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=CC=C(C=C2)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)