Products 514-66-9
CAS 514-66-9 appears in our catalog under these names: Rubropunctamine, Rubropunctatin, Rubropunctamine, ≥98%, ≥98%, Rubropunctamine, 95.0%, Rubropunctamine, min. 95 %, 1 mg. Offered by: Chemat Brand, TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: on request, 25mg, 50mg, 100mg, 2mg, 1mg, 5mg, 10mg.
(3E,9aR)-3-(1-hydroxyhexylidene)-9a-methyl-6-[(E)-prop-1-enyl]furo[3,2-g]isoquinoline-2,9-dione (CAS 514-66-9) is a chemical compound with the molecular formula C21H23NO4 and a molecular weight of 353.4 g/mol. IUPAC name: (3E,9aR)-3-(1-hydroxyhexylidene)-9a-methyl-6-[(E)-prop-1-enyl]furo[3,2-g]isoquinoline-2,9-dione. InChIKey: WTEXYKPGDKLLCW-CLFFMEQDSA-N.
| Molecular formula | C21H23NO4 |
|---|---|
| Molecular weight | 353.4 g/mol |
| IUPAC name | (3E,9aR)-3-(1-hydroxyhexylidene)-9a-methyl-6-[(E)-prop-1-enyl]furo[3,2-g]isoquinoline-2,9-dione |
| InChIKey | WTEXYKPGDKLLCW-CLFFMEQDSA-N |
| SMILES | CCCCC/C(=C\1/C2=CC3=CC(=NC=C3C(=O)[C@@]2(OC1=O)C)/C=C/C)/O |
Computed by PubChem (NCBI)
Synonyms:
Rubropunctamine, Rubropunctatamine