Products 51488-33-6
CAS 51488-33-6 appears in our catalog under these names: 3，4–Dimethoxybenzimidamide hydrochloride, 3,4-Dimethoxy-Benzamidine HCl, 3,4-Dimethoxybenzimidamide hydrochloride 98%, 3,4-Dimethoxy-benzamidine, HCl, 98%, 98%, 3,4-DIMETHOXYBENZAMIDINE HCL, 95%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 10g.
[amino-(3,4-dimethoxyphenyl)methylidene]azanium chloride (CAS 51488-33-6) is a chemical compound with the molecular formula C9H13ClN2O2 and a molecular weight of 216.66 g/mol. IUPAC name: [amino-(3,4-dimethoxyphenyl)methylidene]azanium chloride. InChIKey: JTKNCRAAATVMFV-UHFFFAOYSA-N.
| Molecular formula | C9H13ClN2O2 |
|---|---|
| Molecular weight | 216.66 g/mol |
| IUPAC name | [amino-(3,4-dimethoxyphenyl)methylidene]azanium chloride |
| InChIKey | JTKNCRAAATVMFV-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C(=[NH2+])N)OC.[Cl-] |
Computed by PubChem (NCBI)