Products 51522-30-6
CAS 51522-30-6 is the registry number for 5,7-Dinitro-1,2,3,4-tetrahydronaphthalene, >95%. Offered by: Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g.
5,7-dinitro-1,2,3,4-tetrahydronaphthalene (CAS 51522-30-6) is a chemical compound with the molecular formula C10H10N2O4 and a molecular weight of 222.20 g/mol. IUPAC name: 5,7-dinitro-1,2,3,4-tetrahydronaphthalene. InChIKey: XYARKBJAQYVUJO-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O4 |
|---|---|
| Molecular weight | 222.20 g/mol |
| IUPAC name | 5,7-dinitro-1,2,3,4-tetrahydronaphthalene |
| InChIKey | XYARKBJAQYVUJO-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(C1)C=C(C=C2[N+](=O)[O-])[N+](=O)[O-] |
Computed by PubChem (NCBI)