Products 51557-26-7
CAS 51557-26-7 appears in our catalog under these names: 3–(2–Naphthyl)acrylic acid, 3-(2-Naphthyl)acrylic acid, 3-(Naphthalen-2-yl)acrylic acid 98% (E), 3-(Naphthalen-2-yl)acrylic acid, 98% (E), 98% (E), 3-(Naphthalen-2-yl)acrylic acid, 97%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 5g, 50g, 100g, 250g, 100mg, 250mg.
(E)-3-naphthalen-2-ylprop-2-enoic acid (CAS 51557-26-7) is a chemical compound with the molecular formula C13H10O2 and a molecular weight of 198.22 g/mol. IUPAC name: (E)-3-naphthalen-2-ylprop-2-enoic acid. InChIKey: KWGPBDBAAXYWOJ-SOFGYWHQSA-N.
| Molecular formula | C13H10O2 |
|---|---|
| Molecular weight | 198.22 g/mol |
| IUPAC name | (E)-3-naphthalen-2-ylprop-2-enoic acid |
| InChIKey | KWGPBDBAAXYWOJ-SOFGYWHQSA-N |
| SMILES | C1=CC=C2C=C(C=CC2=C1)/C=C/C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
3-(naphth-2-yl)acrylic acid, 3-(2-Naphthyl)Acrylic Acid, (E)-3-(naphthalen-2-yl)acrylic acid, 3-naphthalen-2-yl-acrylic acid, (E)-3-naphthalen-2-ylprop-2-enoic acid, (2E)-3-(naphthalen-2-yl)prop-2-enoic acid, (E)-3-(2-naphthyl)prop-2-enoic acid, (2E)-3-(2-naphthyl)prop-2-enoic acid, 3-(naphthalen-2-yl)prop-2-enoic acid, (E)-3-(2-Naphthyl)acrylic acid