Products 51747-43-4
CAS 51747-43-4 is the registry number for 2-(4-Chlorophenyl)prop-2-enoic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-(4-chlorophenyl)prop-2-enoic acid (CAS 51747-43-4) is a chemical compound with the molecular formula C9H7ClO2 and a molecular weight of 182.60 g/mol. IUPAC name: 2-(4-chlorophenyl)prop-2-enoic acid. InChIKey: IAXZBSWYBYZRQZ-UHFFFAOYSA-N.
| Molecular formula | C9H7ClO2 |
|---|---|
| Molecular weight | 182.60 g/mol |
| IUPAC name | 2-(4-chlorophenyl)prop-2-enoic acid |
| InChIKey | IAXZBSWYBYZRQZ-UHFFFAOYSA-N |
| SMILES | C=C(C1=CC=C(C=C1)Cl)C(=O)O |
Computed by PubChem (NCBI)