CAS 5176-14-7 is the registry number for 3-Phenylbenzo[c]isoxazole, 95+%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
3-phenyl-2,1-benzoxazole (CAS 5176-14-7) is a chemical compound with the molecular formula C13H9NO and a molecular weight of 195.22 g/mol. IUPAC name: 3-phenyl-2,1-benzoxazole. InChIKey: HTNPXVDBSMVQMI-UHFFFAOYSA-N.
| Molecular formula | C13H9NO |
|---|---|
| Molecular weight | 195.22 g/mol |
| IUPAC name | 3-phenyl-2,1-benzoxazole |
| InChIKey | HTNPXVDBSMVQMI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C3C=CC=CC3=NO2 |
Computed by PubChem (NCBI)