CAS 5176-91-0 appears in our catalog under these names: 2-Chloro-6,9-dimethyl-9H-purine, 97%, 2-Chloro-6,9-dimethyl-9H-purine, 95%, 95%. Offered by: AmBeed, Chemat. Available pack sizes: 10g, 100mg, 250mg.
2-chloro-6,9-dimethylpurine (CAS 5176-91-0) is a chemical compound with the molecular formula C7H7ClN4 and a molecular weight of 182.61 g/mol. IUPAC name: 2-chloro-6,9-dimethylpurine. InChIKey: IMESDNKNMQDHLR-UHFFFAOYSA-N.
| Molecular formula | C7H7ClN4 |
|---|---|
| Molecular weight | 182.61 g/mol |
| IUPAC name | 2-chloro-6,9-dimethylpurine |
| InChIKey | IMESDNKNMQDHLR-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=NC(=N1)Cl)N(C=N2)C |
Computed by PubChem (NCBI)