CAS 51814-19-8 appears in our catalog under these names: 1,3-Pyrrolidinedicarboxylic acid, 4-oxo-, 3-ethyl 1-(phenylmethyl) ester, 95%, 95%, Ethyl 1-N-Cbz-4-oxo-pyrrolidine-3-carboxylate, 95%, 1-Benzyl 3-ethyl 4-oxopyrrolidine-1,3-dicarboxylate, 95%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 500g.
1-O-benzyl 3-O-ethyl 4-oxopyrrolidine-1,3-dicarboxylate (CAS 51814-19-8) is a chemical compound with the molecular formula C15H17NO5 and a molecular weight of 291.30 g/mol. IUPAC name: 1-O-benzyl 3-O-ethyl 4-oxopyrrolidine-1,3-dicarboxylate. InChIKey: FRNZCPLVDNHRIH-UHFFFAOYSA-N.
| Molecular formula | C15H17NO5 |
|---|---|
| Molecular weight | 291.30 g/mol |
| IUPAC name | 1-O-benzyl 3-O-ethyl 4-oxopyrrolidine-1,3-dicarboxylate |
| InChIKey | FRNZCPLVDNHRIH-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1CN(CC1=O)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)