Products 519059-11-1
CAS 519059-11-1 appears in our catalog under these names: 3-Cyano-4-fluorophenylacetic acid, 95%, 2–(3–Cyano–4–fluorophenyl)acetic acid, 2-(3-Cyano-4-fluorophenyl)acetic acid 95%, 2-(3-Cyano-4-fluorophenyl)acetic acid, 95%, 95%, 2-(3-Cyano-4-fluorophenyl)acetic acid, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 100mg, 100g, 25g, 10g.
2-(3-cyano-4-fluorophenyl)acetic acid (CAS 519059-11-1) is a chemical compound with the molecular formula C9H6FNO2 and a molecular weight of 179.15 g/mol. IUPAC name: 2-(3-cyano-4-fluorophenyl)acetic acid. InChIKey: DOBONCGSXZWPIJ-UHFFFAOYSA-N.
| Molecular formula | C9H6FNO2 |
|---|---|
| Molecular weight | 179.15 g/mol |
| IUPAC name | 2-(3-cyano-4-fluorophenyl)acetic acid |
| InChIKey | DOBONCGSXZWPIJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1CC(=O)O)C#N)F |
Computed by PubChem (NCBI)