Products 51934-37-3
CAS 51934-37-3 appears in our catalog under these names: 5-Methoxynaphthalene-1-carboxylic acid, 95%, 5-Methoxy-1-naphthoic acid, 5-Methoxy-1-naphthoic acid 95+%, 5-methoxynaphthalene-1-carboxylic Acid, 95+%, 95+%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat. Available pack sizes: 1g, 250mg, 5g, 2,5g, 100mg.
5-methoxynaphthalene-1-carboxylic acid (CAS 51934-37-3) is a chemical compound with the molecular formula C12H10O3 and a molecular weight of 202.21 g/mol. IUPAC name: 5-methoxynaphthalene-1-carboxylic acid. InChIKey: XOAHGFTUIRAVTN-UHFFFAOYSA-N.
| Molecular formula | C12H10O3 |
|---|---|
| Molecular weight | 202.21 g/mol |
| IUPAC name | 5-methoxynaphthalene-1-carboxylic acid |
| InChIKey | XOAHGFTUIRAVTN-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC2=C1C=CC=C2C(=O)O |
Computed by PubChem (NCBI)