CAS 51991-39-0 appears in our catalog under these names: Methyl 5-hydroxy-1H-indole-2-carboxylate, 97%, Methyl 5-hydroxy-1H-indole-2-carboxylate. Offered by: AmBeed, Biosynth. Available pack sizes: 25g, 100mg, 1g.
Methyl 5-hydroxy-1H-indole-2-carboxylate (CAS 51991-39-0) is a chemical compound with the molecular formula C10H9NO3 and a molecular weight of 191.18 g/mol. IUPAC name: methyl 5-hydroxy-1H-indole-2-carboxylate. InChIKey: JOGDFBLWRNQZRO-UHFFFAOYSA-N.
| Molecular formula | C10H9NO3 |
|---|---|
| Molecular weight | 191.18 g/mol |
| IUPAC name | methyl 5-hydroxy-1H-indole-2-carboxylate |
| InChIKey | JOGDFBLWRNQZRO-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(N1)C=CC(=C2)O |
Computed by PubChem (NCBI)