CAS 52009-53-7 appears in our catalog under these names: 2–Chloro–3,4–dimethoxybenzoic acid, 2-Chloro-3,4-dimethoxybenzoic acid 98%, 2-CHLORO-3,4-DIMETHOXYBENZOIC ACID, 97%, Benzoic acid, 2-chloro-3,4-dimethoxy-, 98%, 98%. Offered by: GLPBio, Ambeed, Sigma-Aldrich, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 500g, 1g, 100g, 10g.
2-chloro-3,4-dimethoxybenzoic acid (CAS 52009-53-7) is a chemical compound with the molecular formula C9H9ClO4 and a molecular weight of 216.62 g/mol. IUPAC name: 2-chloro-3,4-dimethoxybenzoic acid. InChIKey: YSEIYOHXERRMNN-UHFFFAOYSA-N.
| Molecular formula | C9H9ClO4 |
|---|---|
| Molecular weight | 216.62 g/mol |
| IUPAC name | 2-chloro-3,4-dimethoxybenzoic acid |
| InChIKey | YSEIYOHXERRMNN-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)C(=O)O)Cl)OC |
Computed by PubChem (NCBI)