CAS 5204-46-6 appears in our catalog under these names: 4-Amino-2,6-dichlorobenzoic acid, 4-Amino-2,6-dichlorobenzoic acid 95%, 4-Amino-2,6-dichlorobenzoic acid, 95%, 95%, 4-Amino-2,6-dichlorobenzoic acid, 95%. Offered by: Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 50mg, 0,5g, 1g.
4-amino-2,6-dichlorobenzoic acid (CAS 5204-46-6) is a chemical compound with the molecular formula C7H5Cl2NO2 and a molecular weight of 206.02 g/mol. IUPAC name: 4-amino-2,6-dichlorobenzoic acid. InChIKey: IUMLFJXZSWXTEC-UHFFFAOYSA-N.
| Molecular formula | C7H5Cl2NO2 |
|---|---|
| Molecular weight | 206.02 g/mol |
| IUPAC name | 4-amino-2,6-dichlorobenzoic acid |
| InChIKey | IUMLFJXZSWXTEC-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Cl)C(=O)O)Cl)N |
Computed by PubChem (NCBI)