Products 521-51-7
CAS 521-51-7 is the registry number for Pedicin. Offered by: MedChemExpress. Available pack sizes: Get quote.
(E)-1-(2,5-dihydroxy-3,4,6-trimethoxyphenyl)-3-phenylprop-2-en-1-one (CAS 521-51-7) is a chemical compound with the molecular formula C18H18O6 and a molecular weight of 330.3 g/mol. IUPAC name: (E)-1-(2,5-dihydroxy-3,4,6-trimethoxyphenyl)-3-phenylprop-2-en-1-one. InChIKey: PPRMAMORBLMPSR-MDZDMXLPSA-N.
| Molecular formula | C18H18O6 |
|---|---|
| Molecular weight | 330.3 g/mol |
| IUPAC name | (E)-1-(2,5-dihydroxy-3,4,6-trimethoxyphenyl)-3-phenylprop-2-en-1-one |
| InChIKey | PPRMAMORBLMPSR-MDZDMXLPSA-N |
| SMILES | COC1=C(C(=C(C(=C1C(=O)/C=C/C2=CC=CC=C2)O)OC)OC)O |
Computed by PubChem (NCBI)