CAS 521980-85-8 is the registry number for Dimethyl 5-bromopyridine-3,4-dicarboxylate, 95%. Offered by: AmBeed. Available pack sizes: 1g.
Dimethyl 5-bromopyridine-3,4-dicarboxylate (CAS 521980-85-8) is a chemical compound with the molecular formula C9H8BrNO4 and a molecular weight of 274.07 g/mol. IUPAC name: dimethyl 5-bromopyridine-3,4-dicarboxylate. InChIKey: GVEINVSPZGSCHE-UHFFFAOYSA-N.
| Molecular formula | C9H8BrNO4 |
|---|---|
| Molecular weight | 274.07 g/mol |
| IUPAC name | dimethyl 5-bromopyridine-3,4-dicarboxylate |
| InChIKey | GVEINVSPZGSCHE-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CN=CC(=C1C(=O)OC)Br |
Computed by PubChem (NCBI)