Products 52280-85-0

CAS 52280-85-0 is the registry number for 7-Methoxy-2-oxo-1,2-dihydroquinoline-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

7-methoxy-2-oxo-1H-quinoline-4-carboxylic acid (CAS 52280-85-0) is a chemical compound with the molecular formula C11H9NO4 and a molecular weight of 219.19 g/mol. IUPAC name: 7-methoxy-2-oxo-1H-quinoline-4-carboxylic acid. InChIKey: FNDGQJCUHITQOE-UHFFFAOYSA-N.

Identity
Molecular formulaC11H9NO4
Molecular weight219.19 g/mol
IUPAC name7-methoxy-2-oxo-1H-quinoline-4-carboxylic acid
InChIKeyFNDGQJCUHITQOE-UHFFFAOYSA-N
SMILESCOC1=CC2=C(C=C1)C(=CC(=O)N2)C(=O)O

Computed by PubChem (NCBI)