Products 72784-23-7

CAS 72784-23-7 is the registry number for 7-Hydroxy-8-methoxy-4-oxo-4,10-dihydropyrimido[4,5-b]quinoline-2-carboxylic acid mono(trifluoroacetate salt), 95%. Offered by: Chemat Brand. Available pack sizes: on request.

7-methoxy-2-oxo-1H-quinoline-4-carboxylic acid (CAS 72784-23-7) is a chemical compound with the molecular formula C11H9NO4 and a molecular weight of 219.19 g/mol. IUPAC name: 7-methoxy-2-oxo-1H-quinoline-4-carboxylic acid. InChIKey: FNDGQJCUHITQOE-UHFFFAOYSA-N.

Identity
Molecular formulaC11H9NO4
Molecular weight219.19 g/mol
IUPAC name7-methoxy-2-oxo-1H-quinoline-4-carboxylic acid
InChIKeyFNDGQJCUHITQOE-UHFFFAOYSA-N
SMILESCOC1=CC2=C(C=C1)C(=CC(=O)N2)C(=O)O

Computed by PubChem (NCBI)