Products 52320-61-3

CAS 52320-61-3 is the registry number for 3-(2-AMINOETHYL)BENZENE-1-SULFONAMIDE HYDROCHLORIDE, 95%, 95%. Offered by: Chemat. Available pack sizes: 10mg, 25mg, 100mg.

Structural formula: {0} (CAS {1})

3-(2-aminoethyl)benzenesulfonamide;hydrochloride (CAS 52320-61-3) is a chemical compound with the molecular formula C8H13ClN2O2S and a molecular weight of 236.72 g/mol. IUPAC name: 3-(2-aminoethyl)benzenesulfonamide;hydrochloride. InChIKey: QWJCVZNCTVTDSF-UHFFFAOYSA-N.

Identity
Molecular formulaC8H13ClN2O2S
Molecular weight236.72 g/mol
IUPAC name3-(2-aminoethyl)benzenesulfonamide;hydrochloride
InChIKeyQWJCVZNCTVTDSF-UHFFFAOYSA-N
SMILESC1=CC(=CC(=C1)S(=O)(=O)N)CCN.Cl

Computed by PubChem (NCBI)