CAS 52320-61-3 is the registry number for 3-(2-AMINOETHYL)BENZENE-1-SULFONAMIDE HYDROCHLORIDE, 95%, 95%. Offered by: Chemat. Available pack sizes: 10mg, 25mg, 100mg.
3-(2-aminoethyl)benzenesulfonamide;hydrochloride (CAS 52320-61-3) is a chemical compound with the molecular formula C8H13ClN2O2S and a molecular weight of 236.72 g/mol. IUPAC name: 3-(2-aminoethyl)benzenesulfonamide;hydrochloride. InChIKey: QWJCVZNCTVTDSF-UHFFFAOYSA-N.
| Molecular formula | C8H13ClN2O2S |
|---|---|
| Molecular weight | 236.72 g/mol |
| IUPAC name | 3-(2-aminoethyl)benzenesulfonamide;hydrochloride |
| InChIKey | QWJCVZNCTVTDSF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)S(=O)(=O)N)CCN.Cl |
Computed by PubChem (NCBI)