Products 52393-53-0
CAS 52393-53-0 is the registry number for Yashabushidiol A. Offered by: TargetMol, MedChemExpress. Available pack sizes: 5mg, 1 mg.
(3S,5R)-1,7-diphenylheptane-3,5-diol (CAS 52393-53-0) is a chemical compound with the molecular formula C19H24O2 and a molecular weight of 284.4 g/mol. IUPAC name: (3S,5R)-1,7-diphenylheptane-3,5-diol. InChIKey: QSUSPILNZCEGPK-KDURUIRLSA-N.
| Molecular formula | C19H24O2 |
|---|---|
| Molecular weight | 284.4 g/mol |
| IUPAC name | (3S,5R)-1,7-diphenylheptane-3,5-diol |
| InChIKey | QSUSPILNZCEGPK-KDURUIRLSA-N |
| SMILES | C1=CC=C(C=C1)CC[C@H](C[C@H](CCC2=CC=CC=C2)O)O |
Computed by PubChem (NCBI)
Synonyms:
Yashabushidiol A, orb1680368