Products 52436-88-1
CAS 52436-88-1 is the registry number for β-Nor-lapachone. Offered by: MedChemExpress. Available pack sizes: Get quote.
2,2-dimethyl-3H-benzo[g][1]benzofuran-4,5-dione (CAS 52436-88-1) is a chemical compound with the molecular formula C14H12O3 and a molecular weight of 228.24 g/mol. IUPAC name: 2,2-dimethyl-3H-benzo[g][1]benzofuran-4,5-dione. InChIKey: DMSVAEFGRLMACV-UHFFFAOYSA-N.
| Molecular formula | C14H12O3 |
|---|---|
| Molecular weight | 228.24 g/mol |
| IUPAC name | 2,2-dimethyl-3H-benzo[g][1]benzofuran-4,5-dione |
| InChIKey | DMSVAEFGRLMACV-UHFFFAOYSA-N |
| SMILES | CC1(CC2=C(O1)C3=CC=CC=C3C(=O)C2=O)C |
Computed by PubChem (NCBI)