Products 52465-55-1
CAS 52465-55-1 is the registry number for 1-Oxo-3,4-dihydro-1H-2-benzopyran-7-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
1-oxo-3,4-dihydroisochromene-7-carboxylic acid (CAS 52465-55-1) is a chemical compound with the molecular formula C10H8O4 and a molecular weight of 192.17 g/mol. IUPAC name: 1-oxo-3,4-dihydroisochromene-7-carboxylic acid. InChIKey: MOPVVNQYYAUTKQ-UHFFFAOYSA-N.
| Molecular formula | C10H8O4 |
|---|---|
| Molecular weight | 192.17 g/mol |
| IUPAC name | 1-oxo-3,4-dihydroisochromene-7-carboxylic acid |
| InChIKey | MOPVVNQYYAUTKQ-UHFFFAOYSA-N |
| SMILES | C1COC(=O)C2=C1C=CC(=C2)C(=O)O |
Computed by PubChem (NCBI)