CAS 52786-67-1 appears in our catalog under these names: 2-(2-Cyano-4-methoxyphenyl)acetic acid, 95%, 2-(2-Cyano-4-methoxyphenyl)acetic acid 98%, 2-(2-Cyano-4-methoxyphenyl)acetic acid, 98%, 98%, 2-(2-Cyano-4-methoxyphenyl)acetic acid, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 100mg, 1g, 5g.
2-(2-cyano-4-methoxyphenyl)acetic acid (CAS 52786-67-1) is a chemical compound with the molecular formula C10H9NO3 and a molecular weight of 191.18 g/mol. IUPAC name: 2-(2-cyano-4-methoxyphenyl)acetic acid. InChIKey: JVYVOEJCUPVLEQ-UHFFFAOYSA-N.
| Molecular formula | C10H9NO3 |
|---|---|
| Molecular weight | 191.18 g/mol |
| IUPAC name | 2-(2-cyano-4-methoxyphenyl)acetic acid |
| InChIKey | JVYVOEJCUPVLEQ-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)CC(=O)O)C#N |
Computed by PubChem (NCBI)