Products 52787-17-4

CAS 52787-17-4 is the registry number for 4-(Carbamoylmethyl)benzoic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

4-(2-amino-2-oxoethyl)benzoic acid (CAS 52787-17-4) is a chemical compound with the molecular formula C9H9NO3 and a molecular weight of 179.17 g/mol. IUPAC name: 4-(2-amino-2-oxoethyl)benzoic acid. InChIKey: YMKXCDDRWMQOBA-UHFFFAOYSA-N.

Identity
Molecular formulaC9H9NO3
Molecular weight179.17 g/mol
IUPAC name4-(2-amino-2-oxoethyl)benzoic acid
InChIKeyYMKXCDDRWMQOBA-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1CC(=O)N)C(=O)O

Computed by PubChem (NCBI)