CAS 528872-23-3 appears in our catalog under these names: Ethyl 4-bromo-2-nitrobenzoate, 95%, Ethyl 4-bromo-2-nitrobenzoate, 95+%, Ethyl 4-bromo-2-nitrobenzoate. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 250mg, 5g, 0,5g, 50mg.
Ethyl 4-bromo-2-nitrobenzoate (CAS 528872-23-3) is a chemical compound with the molecular formula C9H8BrNO4 and a molecular weight of 274.07 g/mol. IUPAC name: ethyl 4-bromo-2-nitrobenzoate. InChIKey: HBBNMJSSYTXTPH-UHFFFAOYSA-N.
| Molecular formula | C9H8BrNO4 |
|---|---|
| Molecular weight | 274.07 g/mol |
| IUPAC name | ethyl 4-bromo-2-nitrobenzoate |
| InChIKey | HBBNMJSSYTXTPH-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C=C(C=C1)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)