CAS 52938-97-3 appears in our catalog under these names: 5-Phenylfuran-2-carboxylic acid, 97%, 97%, 5-Phenylfuran-2-carboxylic acid 97%, 5-PHENYL-2-FUROIC ACID, 97%, 5-Phenyl-2-furoic acid, 95%, 5–Phenyl–2–furancarboxylic Acid. Offered by: Chemat, Ambeed, Sigma-Aldrich, Combi-blocks, GLPBio. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
5-phenylfuran-2-carboxylic acid (CAS 52938-97-3) is a chemical compound with the molecular formula C11H8O3 and a molecular weight of 188.18 g/mol. IUPAC name: 5-phenylfuran-2-carboxylic acid. InChIKey: GUOMINFEASCICM-UHFFFAOYSA-N.
| Molecular formula | C11H8O3 |
|---|---|
| Molecular weight | 188.18 g/mol |
| IUPAC name | 5-phenylfuran-2-carboxylic acid |
| InChIKey | GUOMINFEASCICM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(O2)C(=O)O |
Computed by PubChem (NCBI)