CAS 530080-66-1 appears in our catalog under these names: 4-(4-bromophenyl)-2-methyl-1,2,4-triazol-3-one, 95%, 4-(4-Bromophenyl)-2-methyl-2,4-dihydro-3H-1,2,4-triazol-3-one 95%, 4-(4-Bromophenyl)-2-methyl-2,4-dihydro-3H-1,2,4-triazol-3-one, 97%, 97%. Offered by: Chemat Brand, Ambeed, Chemat. Available pack sizes: on request, 1g, 5g, 25g, 100g, 250mg, 10g.
4-(4-bromophenyl)-2-methyl-1,2,4-triazol-3-one (CAS 530080-66-1) is a chemical compound with the molecular formula C9H8BrN3O and a molecular weight of 254.08 g/mol. IUPAC name: 4-(4-bromophenyl)-2-methyl-1,2,4-triazol-3-one. InChIKey: HCQKRWOQZCZJGS-UHFFFAOYSA-N.
| Molecular formula | C9H8BrN3O |
|---|---|
| Molecular weight | 254.08 g/mol |
| IUPAC name | 4-(4-bromophenyl)-2-methyl-1,2,4-triazol-3-one |
| InChIKey | HCQKRWOQZCZJGS-UHFFFAOYSA-N |
| SMILES | CN1C(=O)N(C=N1)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)