CAS 53059-30-6 is the registry number for 4-(3-Nitrophenyl)phenol, 97%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
4-(3-nitrophenyl)phenol (CAS 53059-30-6) is a chemical compound with the molecular formula C12H9NO3 and a molecular weight of 215.20 g/mol. IUPAC name: 4-(3-nitrophenyl)phenol. InChIKey: UNJAJDWFIYUSJV-UHFFFAOYSA-N.
| Molecular formula | C12H9NO3 |
|---|---|
| Molecular weight | 215.20 g/mol |
| IUPAC name | 4-(3-nitrophenyl)phenol |
| InChIKey | UNJAJDWFIYUSJV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)[N+](=O)[O-])C2=CC=C(C=C2)O |
Computed by PubChem (NCBI)