Products 53670-70-5
CAS 53670-70-5 is the registry number for Ethyl 2-acetyl-3-methyl-4-oxopentanoate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Ethyl 2-acetyl-3-methyl-4-oxopentanoate (CAS 53670-70-5) is a chemical compound with the molecular formula C10H16O4 and a molecular weight of 200.23 g/mol. IUPAC name: ethyl 2-acetyl-3-methyl-4-oxopentanoate. InChIKey: CQYLSOVNYJDNEY-UHFFFAOYSA-N.
| Molecular formula | C10H16O4 |
|---|---|
| Molecular weight | 200.23 g/mol |
| IUPAC name | ethyl 2-acetyl-3-methyl-4-oxopentanoate |
| InChIKey | CQYLSOVNYJDNEY-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C(C)C(=O)C)C(=O)C |
Computed by PubChem (NCBI)