CAS 53689-25-1 is the registry number for N-(5-chloro-2-ethoxyphenyl)acetamide. Offered by: Chemat Brand. Available pack sizes: on request.
N-(5-chloro-2-ethoxyphenyl)acetamide (CAS 53689-25-1) is a chemical compound with the molecular formula C10H12ClNO2 and a molecular weight of 213.66 g/mol. IUPAC name: N-(5-chloro-2-ethoxyphenyl)acetamide. InChIKey: GFLADJWUPYTLDK-UHFFFAOYSA-N.
| Molecular formula | C10H12ClNO2 |
|---|---|
| Molecular weight | 213.66 g/mol |
| IUPAC name | N-(5-chloro-2-ethoxyphenyl)acetamide |
| InChIKey | GFLADJWUPYTLDK-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=C(C=C1)Cl)NC(=O)C |
Computed by PubChem (NCBI)