CAS 53689-84-2 is the registry number for 1-(4-Benzoylphenyl)ethanone 97%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
1-(4-benzoylphenyl)ethanone (CAS 53689-84-2) is a chemical compound with the molecular formula C15H12O2 and a molecular weight of 224.25 g/mol. IUPAC name: 1-(4-benzoylphenyl)ethanone. InChIKey: DULLEKOHORMWFS-UHFFFAOYSA-N.
| Molecular formula | C15H12O2 |
|---|---|
| Molecular weight | 224.25 g/mol |
| IUPAC name | 1-(4-benzoylphenyl)ethanone |
| InChIKey | DULLEKOHORMWFS-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC=C(C=C1)C(=O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)