CAS 53868-44-3 is the registry number for 2-(2-Nitrophenyl)malondialdehyde, >95% (HPLC). Offered by: TRC. Available pack sizes: 100mg, 1g, 500mg.
2-(2-nitrophenyl)propanedial (CAS 53868-44-3) is a chemical compound with the molecular formula C9H7NO4 and a molecular weight of 193.16 g/mol. IUPAC name: 2-(2-nitrophenyl)propanedial. InChIKey: MXGSZJWKJZPIRF-UHFFFAOYSA-N.
| Molecular formula | C9H7NO4 |
|---|---|
| Molecular weight | 193.16 g/mol |
| IUPAC name | 2-(2-nitrophenyl)propanedial |
| InChIKey | MXGSZJWKJZPIRF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(C=O)C=O)[N+](=O)[O-] |
Computed by PubChem (NCBI)