CAS 541522-89-8 appears in our catalog under these names: 6-Hydroxy-1-methyl-1H-indole-2-carboxylic Acid, 6-Hydroxy-1-methyl-1H-indole-2-carboxylic acid, 98%. Offered by: TRC, AmBeed, Biosynth. Available pack sizes: 2,5g, 5g, 50mg, 0,5g.
6-hydroxy-1-methylindole-2-carboxylic acid (CAS 541522-89-8) is a chemical compound with the molecular formula C10H9NO3 and a molecular weight of 191.18 g/mol. IUPAC name: 6-hydroxy-1-methylindole-2-carboxylic acid. InChIKey: JKXFXYLSGNVODW-UHFFFAOYSA-N.
| Molecular formula | C10H9NO3 |
|---|---|
| Molecular weight | 191.18 g/mol |
| IUPAC name | 6-hydroxy-1-methylindole-2-carboxylic acid |
| InChIKey | JKXFXYLSGNVODW-UHFFFAOYSA-N |
| SMILES | CN1C(=CC2=C1C=C(C=C2)O)C(=O)O |
Computed by PubChem (NCBI)