CAS 54255-63-9 is the registry number for 5-Nitro-2-phenoxybenzoic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
5-nitro-2-phenoxybenzoic acid (CAS 54255-63-9) is a chemical compound with the molecular formula C13H9NO5 and a molecular weight of 259.21 g/mol. IUPAC name: 5-nitro-2-phenoxybenzoic acid. InChIKey: NCHLUKFIXIOAPI-UHFFFAOYSA-N.
| Molecular formula | C13H9NO5 |
|---|---|
| Molecular weight | 259.21 g/mol |
| IUPAC name | 5-nitro-2-phenoxybenzoic acid |
| InChIKey | NCHLUKFIXIOAPI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=C(C=C(C=C2)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)