CAS 5434-50-4 is the registry number for 2-(6-Bromo-1,3-dioxaindan-5-yl)acetonitrile. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-(6-bromo-1,3-benzodioxol-5-yl)acetonitrile (CAS 5434-50-4) is a chemical compound with the molecular formula C9H6BrNO2 and a molecular weight of 240.05 g/mol. IUPAC name: 2-(6-bromo-1,3-benzodioxol-5-yl)acetonitrile. InChIKey: LOVANXUAZPZJSN-UHFFFAOYSA-N.
| Molecular formula | C9H6BrNO2 |
|---|---|
| Molecular weight | 240.05 g/mol |
| IUPAC name | 2-(6-bromo-1,3-benzodioxol-5-yl)acetonitrile |
| InChIKey | LOVANXUAZPZJSN-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C(=C2)CC#N)Br |
Computed by PubChem (NCBI)