CAS 54395-36-7 is the registry number for 2-Butyl-4-nitro-1H-isoindole-1,3(2H)-dione, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g.
2-butyl-4-nitroisoindole-1,3-dione (CAS 54395-36-7) is a chemical compound with the molecular formula C12H12N2O4 and a molecular weight of 248.23 g/mol. IUPAC name: 2-butyl-4-nitroisoindole-1,3-dione. InChIKey: OLOUZLFUNQCQEA-UHFFFAOYSA-N.
| Molecular formula | C12H12N2O4 |
|---|---|
| Molecular weight | 248.23 g/mol |
| IUPAC name | 2-butyl-4-nitroisoindole-1,3-dione |
| InChIKey | OLOUZLFUNQCQEA-UHFFFAOYSA-N |
| SMILES | CCCCN1C(=O)C2=C(C1=O)C(=CC=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)