CAS 54445-01-1 is the registry number for 7-Methoxy-3,4-dihydro-2H-1-benzopyran-3-amine hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 1g, 5g.
7-methoxy-3,4-dihydro-2H-chromen-3-amine;hydrochloride (CAS 54445-01-1) is a chemical compound with the molecular formula C10H14ClNO2 and a molecular weight of 215.67 g/mol. IUPAC name: 7-methoxy-3,4-dihydro-2H-chromen-3-amine;hydrochloride. InChIKey: MEDKKMCXWLRRSU-UHFFFAOYSA-N.
| Molecular formula | C10H14ClNO2 |
|---|---|
| Molecular weight | 215.67 g/mol |
| IUPAC name | 7-methoxy-3,4-dihydro-2H-chromen-3-amine;hydrochloride |
| InChIKey | MEDKKMCXWLRRSU-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(CC(CO2)N)C=C1.Cl |
Computed by PubChem (NCBI)