Products 54447-57-3
CAS 54447-57-3 appears in our catalog under these names: Adenosine-5'-13C, Adenosine–13C, Adenosine-13C, 99.0%, 99.0%, Adenosine-13C, 99.0%. Offered by: TRC, GLPBio, Chemat, MedChemExpress. Available pack sizes: 10mg, 1mg, 1 mg.
(2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-(hydroxy(113C)methyl)oxolane-3,4-diol (CAS 54447-57-3) is a chemical compound with the molecular formula C10H13N5O4 and a molecular weight of 268.23 g/mol. IUPAC name: (2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-(hydroxy(113C)methyl)oxolane-3,4-diol. InChIKey: OIRDTQYFTABQOQ-XUZOCFOZSA-N.
| Molecular formula | C10H13N5O4 |
|---|---|
| Molecular weight | 268.23 g/mol |
| IUPAC name | (2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-(hydroxy(113C)methyl)oxolane-3,4-diol |
| InChIKey | OIRDTQYFTABQOQ-XUZOCFOZSA-N |
| SMILES | C1=NC(=C2C(=N1)N(C=N2)[C@H]3[C@@H]([C@@H]([C@H](O3)[13CH2]O)O)O)N |
Computed by PubChem (NCBI)