Products 5453-51-0
CAS 5453-51-0 appears in our catalog under these names: 5-((1H-indol-3-yl)methylidene)imidazolidine-2,4-dione, 5-[(1H-indol-3-yl)methylidene]imidazolidine-2,4-dione. Offered by: TargetMol, Chemat. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg.
4-hydroxy-5-[(Z)-indol-3-ylidenemethyl]-1,3-dihydroimidazol-2-one (CAS 5453-51-0) is a chemical compound with the molecular formula C12H9N3O2 and a molecular weight of 227.22 g/mol. IUPAC name: 4-hydroxy-5-[(Z)-indol-3-ylidenemethyl]-1,3-dihydroimidazol-2-one. InChIKey: RBTNARRBWGUBEI-FNORWQNLSA-N.
| Molecular formula | C12H9N3O2 |
|---|---|
| Molecular weight | 227.22 g/mol |
| IUPAC name | 4-hydroxy-5-[(Z)-indol-3-ylidenemethyl]-1,3-dihydroimidazol-2-one |
| InChIKey | RBTNARRBWGUBEI-FNORWQNLSA-N |
| SMILES | C1=CC=C2C(=C1)/C(=C/C3=C(NC(=O)N3)O)/C=N2 |
Computed by PubChem (NCBI)