CAS 54675-27-3 appears in our catalog under these names: 8-Bromo-4-hydroxyquinolin-2(1H)-one 97%, 8-Bromo-4-hydroxyquinolin-2(1H)-one, 97%, 97%, 8-bromo-2-hydroxy-1,4-dihydroquinolin-4-one, 97%, 8-Bromo-4-hydroxyquinolin-2(1H)-one, 97%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
8-bromo-4-hydroxy-1H-quinolin-2-one (CAS 54675-27-3) is a chemical compound with the molecular formula C9H6BrNO2 and a molecular weight of 240.05 g/mol. IUPAC name: 8-bromo-4-hydroxy-1H-quinolin-2-one. InChIKey: YMZASLVENRUONX-UHFFFAOYSA-N.
| Molecular formula | C9H6BrNO2 |
|---|---|
| Molecular weight | 240.05 g/mol |
| IUPAC name | 8-bromo-4-hydroxy-1H-quinolin-2-one |
| InChIKey | YMZASLVENRUONX-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Br)NC(=O)C=C2O |
Computed by PubChem (NCBI)