CAS 5468-85-9 is the registry number for N-Phenylquinolin-2-amine, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g, 25g, 50g, 100g.
N-phenylquinolin-2-amine (CAS 5468-85-9) is a chemical compound with the molecular formula C15H12N2 and a molecular weight of 220.27 g/mol. IUPAC name: N-phenylquinolin-2-amine. InChIKey: NSCFHVXOVBMGAK-UHFFFAOYSA-N.
| Molecular formula | C15H12N2 |
|---|---|
| Molecular weight | 220.27 g/mol |
| IUPAC name | N-phenylquinolin-2-amine |
| InChIKey | NSCFHVXOVBMGAK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC2=NC3=CC=CC=C3C=C2 |
Computed by PubChem (NCBI)