CAS 54802-12-9 appears in our catalog under these names: 2-(2-Cyanophenoxy)acetamide, 98%, 2–(2–Cyanophenoxy)acetamide. Offered by: Combi-blocks, GLPBio. Available pack sizes: 25g, 1g, 5g.
2-(2-cyanophenoxy)acetamide (CAS 54802-12-9) is a chemical compound with the molecular formula C9H8N2O2 and a molecular weight of 176.17 g/mol. IUPAC name: 2-(2-cyanophenoxy)acetamide. InChIKey: RYOYNMJXEHNYAG-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O2 |
|---|---|
| Molecular weight | 176.17 g/mol |
| IUPAC name | 2-(2-cyanophenoxy)acetamide |
| InChIKey | RYOYNMJXEHNYAG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C#N)OCC(=O)N |
Computed by PubChem (NCBI)