CAS 548766-10-5 appears in our catalog under these names: N-(4-Hydroxyphenyl)-N-methyl-2-thienylformamide, N-(4-Hydroxyphenyl)-N-methyl-2-thienylformamide, 95%. Offered by: Biosynth, Fluorochem. Available pack sizes: 25g, 10g, 5g.
N-(4-hydroxyphenyl)-N-methylthiophene-2-carboxamide (CAS 548766-10-5) is a chemical compound with the molecular formula C12H11NO2S and a molecular weight of 233.29 g/mol. IUPAC name: N-(4-hydroxyphenyl)-N-methylthiophene-2-carboxamide. InChIKey: LTCVSWVAJHCFCB-UHFFFAOYSA-N.
| Molecular formula | C12H11NO2S |
|---|---|
| Molecular weight | 233.29 g/mol |
| IUPAC name | N-(4-hydroxyphenyl)-N-methylthiophene-2-carboxamide |
| InChIKey | LTCVSWVAJHCFCB-UHFFFAOYSA-N |
| SMILES | CN(C1=CC=C(C=C1)O)C(=O)C2=CC=CS2 |
Computed by PubChem (NCBI)