CAS 55104-59-1 appears in our catalog under these names: 7-Nitroisochroman-1-one, 98%, 7-Nitro-isochroman-1-one, 98%, 7-Nitro-isochroman-1-one, 98%, 98%. Offered by: Fluorochem, AmBeed, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
7-nitro-3,4-dihydroisochromen-1-one (CAS 55104-59-1) is a chemical compound with the molecular formula C9H7NO4 and a molecular weight of 193.16 g/mol. IUPAC name: 7-nitro-3,4-dihydroisochromen-1-one. InChIKey: IOAGXJFXHVSZIE-UHFFFAOYSA-N.
| Molecular formula | C9H7NO4 |
|---|---|
| Molecular weight | 193.16 g/mol |
| IUPAC name | 7-nitro-3,4-dihydroisochromen-1-one |
| InChIKey | IOAGXJFXHVSZIE-UHFFFAOYSA-N |
| SMILES | C1COC(=O)C2=C1C=CC(=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)