Products 5515-00-4
CAS 5515-00-4 appears in our catalog under these names: Benzyl 6-aminohexanoate hydrochloride, Benzyl 6-aminohexanoate hydrochloride 95%, Benzyl 6-aminohexanoate hydrochloride, 95%, 95%. Offered by: Biosynth, Ambeed, Chemat. Available pack sizes: 50mg, 0,5g, 250mg, 1g, 5g, 10g.
Benzyl 6-aminohexanoate;hydrochloride (CAS 5515-00-4) is a chemical compound with the molecular formula C13H20ClNO2 and a molecular weight of 257.75 g/mol. IUPAC name: benzyl 6-aminohexanoate;hydrochloride. InChIKey: ASOOREZHFIOQKM-UHFFFAOYSA-N.
| Molecular formula | C13H20ClNO2 |
|---|---|
| Molecular weight | 257.75 g/mol |
| IUPAC name | benzyl 6-aminohexanoate;hydrochloride |
| InChIKey | ASOOREZHFIOQKM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)CCCCCN.Cl |
Computed by PubChem (NCBI)