Products 552-86-3
CAS 552-86-3 appears in our catalog under these names: Furoin, 98%, Furoin, 2,2'-Furoin, 98% , Furoin, >96.0%(GC), 2,2-Furoin, 96%, 96%. Offered by: Combi-blocks, GLPBio, Thermo Scientific (Alfa Aesar), TCI, Chemat. Available pack sizes: 1g, 25g, 100g, 5g.
1,2-bis(furan-2-yl)-2-hydroxyethanone (CAS 552-86-3) is a chemical compound with the molecular formula C10H8O4 and a molecular weight of 192.17 g/mol. IUPAC name: 1,2-bis(furan-2-yl)-2-hydroxyethanone. InChIKey: MIJRFWVFNKQQDK-UHFFFAOYSA-N.
| Molecular formula | C10H8O4 |
|---|---|
| Molecular weight | 192.17 g/mol |
| IUPAC name | 1,2-bis(furan-2-yl)-2-hydroxyethanone |
| InChIKey | MIJRFWVFNKQQDK-UHFFFAOYSA-N |
| SMILES | C1=COC(=C1)C(C(=O)C2=CC=CO2)O |
Computed by PubChem (NCBI)