CAS 55496-54-3 is the registry number for 4-Chloro-5,6,7-trimethoxyquinazoline, 95+%. Offered by: AmBeed. Available pack sizes: 1g.
4-chloro-5,6,7-trimethoxyquinazoline (CAS 55496-54-3) is a chemical compound with the molecular formula C11H11ClN2O3 and a molecular weight of 254.67 g/mol. IUPAC name: 4-chloro-5,6,7-trimethoxyquinazoline. InChIKey: MUIRIRMDOFREES-UHFFFAOYSA-N.
| Molecular formula | C11H11ClN2O3 |
|---|---|
| Molecular weight | 254.67 g/mol |
| IUPAC name | 4-chloro-5,6,7-trimethoxyquinazoline |
| InChIKey | MUIRIRMDOFREES-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C2C(=C1)N=CN=C2Cl)OC)OC |
Computed by PubChem (NCBI)